C22H26N2O4 — CID 102257258
methyl (E)-2-[(2S,3R,12bR)-3-ethenyl-10-hydroxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate (PubChem CID 102257258) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is methyl (E)-2-[(2S,3R,12bR)-3-ethenyl-10-hydroxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[(2S,3R,12bR)-3-ethenyl-10-hydroxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 102257258 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | methyl (E)-2-[(2S,3R,12bR)-3-ethenyl-10-hydroxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate |
| SMILES | C=C[C@H]1CN2CCc3c([nH]c4cc(O)ccc34)[C@H]2C[C@@H]1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C22H26N2O4/c1-4-13-11-24-8-7-16-15-6-5-14(25)9-19(15)23-21(16)20(24)10-17(13)18(12-27-2)22(26)28-3/h4-6,9,12-13,17,20,23,25H,1,7-8,10-11H2,2-3H3/b18-12+/t13-,17-,20+/m0/s1 |
| InChIKey | ITSVWWAGISITDN-QEQSYFPRSA-N |
| XLogP | 3.30 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|