C23H30N2O5 — CID 72792948
methyl (2R)-2-[(2S,3R,12bS)-3-ethenyl-9,10-dimethoxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-hydroxypropanoate (PubChem CID 72792948) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is methyl (2R)-2-[(2S,3R,12bS)-3-ethenyl-9,10-dimethoxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-hydroxypropanoate.
| Compound Name | methyl (2R)-2-[(2S,3R,12bS)-3-ethenyl-9,10-dimethoxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 72792948 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | methyl (2R)-2-[(2S,3R,12bS)-3-ethenyl-9,10-dimethoxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-hydroxypropanoate |
| SMILES | C=C[C@H]1CN2CCc3c([nH]c4cc(OC)c(OC)cc34)[C@@H]2C[C@@H]1[C@H](CO)C(=O)OC |
| InChI | InChI=1S/C23H30N2O5/c1-5-13-11-25-7-6-14-16-9-20(28-2)21(29-3)10-18(16)24-22(14)19(25)8-15(13)17(12-26)23(27)30-4/h5,9-10,13,15,17,19,24,26H,1,6-8,11-12H2,2-4H3/t13-,15-,17-,19-/m0/s1 |
| InChIKey | UXKWMJPQXBYIKQ-CJCBUOBESA-N |
| XLogP | 2.69 |
| TPSA | 84.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|