C27H30N2O3 — CID 15285097
methyl 2-[(2R,3Z,12bS)-3-(2-phenylmethoxyethylidene)-2,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]acetate (PubChem CID 15285097) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is methyl 2-[(2R,3Z,12bS)-3-(2-phenylmethoxyethylidene)-2,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3Z,12bS)-3-(2-phenylmethoxyethylidene)-2,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]acetate |
|---|---|
| PubChem CID | 15285097 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | methyl 2-[(2R,3Z,12bS)-3-(2-phenylmethoxyethylidene)-2,4,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1C[C@H]2c3[nH]c4ccccc4c3CCN2C/C1=C\COCc1ccccc1 |
| InChI | InChI=1S/C27H30N2O3/c1-31-26(30)16-21-15-25-27-23(22-9-5-6-10-24(22)28-27)11-13-29(25)17-20(21)12-14-32-18-19-7-3-2-4-8-19/h2-10,12,21,25,28H,11,13-18H2,1H3/b20-12+/t21-,25+/m1/s1 |
| InChIKey | YMEVZTFPBJEAMT-PFVSHTQGSA-N |
| XLogP | 4.79 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|