C24H27N3O4 — CID 10927955
methyl (1R,12bR)-1-(2-acetyloxy-2-cyanoethyl)-1-ethyl-6,7,12,12b-tetrahydro-2H-indolo[2,3-a]quinolizine-3-carboxylate (PubChem CID 10927955) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is methyl (1R,12bR)-1-(2-acetyloxy-2-cyanoethyl)-1-ethyl-6,7,12,12b-tetrahydro-2H-indolo[2,3-a]quinolizine-3-carboxylate.
| Compound Name | methyl (1R,12bR)-1-(2-acetyloxy-2-cyanoethyl)-1-ethyl-6,7,12,12b-tetrahydro-2H-indolo[2,3-a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 10927955 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | methyl (1R,12bR)-1-(2-acetyloxy-2-cyanoethyl)-1-ethyl-6,7,12,12b-tetrahydro-2H-indolo[2,3-a]quinolizine-3-carboxylate |
| SMILES | CC[C@]1(CC(C#N)OC(C)=O)CC(C(=O)OC)=CN2CCc3c([nH]c4ccccc34)[C@H]21 |
| InChI | InChI=1S/C24H27N3O4/c1-4-24(12-17(13-25)31-15(2)28)11-16(23(29)30-3)14-27-10-9-19-18-7-5-6-8-20(18)26-21(19)22(24)27/h5-8,14,17,22,26H,4,9-12H2,1-3H3/t17?,22-,24+/m0/s1 |
| InChIKey | KYPCVWLQPHCEID-PEHCJWRVSA-N |
| XLogP | 3.77 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|