C21H18N2O2 — CID 163117096
methyl 1,3,11,12-tetrahydroyohimban-19-carboxylate (PubChem CID 163117096) has the molecular formula C21H18N2O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is methyl 1,3,11,12-tetrahydroyohimban-19-carboxylate.
| Compound Name | methyl 1,3,11,12-tetrahydroyohimban-19-carboxylate |
|---|---|
| PubChem CID | 163117096 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | methyl 1,3,11,12-tetrahydroyohimban-19-carboxylate |
| SMILES | COC(=O)c1cccc2c1=CC1c3[nH]c4ccccc4c3CCN1C=2 |
| InChI | InChI=1S/C21H18N2O2/c1-25-21(24)16-7-4-5-13-12-23-10-9-15-14-6-2-3-8-18(14)22-20(15)19(23)11-17(13)16/h2-8,11-12,19,22H,9-10H2,1H3 |
| InChIKey | AERDNBBGIYQCAS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|