C20H19N3O2S — CID 23734466
methyl 2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioylamino)benzoate (PubChem CID 23734466) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is methyl 2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioylamino)benzoate.
| Compound Name | methyl 2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioylamino)benzoate |
|---|---|
| PubChem CID | 23734466 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | methyl 2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioylamino)benzoate |
| SMILES | COC(=O)c1ccccc1NC(=S)N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C20H19N3O2S/c1-25-19(24)15-7-3-5-9-17(15)22-20(26)23-11-10-14-13-6-2-4-8-16(13)21-18(14)12-23/h2-9,21H,10-12H2,1H3,(H,22,26) |
| InChIKey | NYKZKRGJSUZGNB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|