C27H25N3O4S — CID 142161808
1,3-benzodioxole;4-[(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioylamino)methyl]benzoic acid (PubChem CID 142161808) has the molecular formula C27H25N3O4S and a molecular weight of 487.58 g/mol. Its IUPAC name is 1,3-benzodioxole;4-[(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioylamino)methyl]benzoic acid.
| Compound Name | 1,3-benzodioxole;4-[(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 142161808 |
| Molecular Formula | C27H25N3O4S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 1,3-benzodioxole;4-[(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=S)N2CCc3c([nH]c4ccccc34)C2)cc1.c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H19N3O2S.C7H6O2/c24-19(25)14-7-5-13(6-8-14)11-21-20(26)23-10-9-16-15-3-1-2-4-17(15)22-18(16)12-23;1-2-4-7-6(3-1)8-5-9-7/h1-8,22H,9-12H2,(H,21,26)(H,24,25);1-4H,5H2 |
| InChIKey | ZULCCZSMWNRBGO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|