C19H18FN3O — CID 23935329
N-(5-fluoro-2-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 23935329) has the molecular formula C19H18FN3O and a molecular weight of 323.37 g/mol. Its IUPAC name is N-(5-fluoro-2-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | N-(5-fluoro-2-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 23935329 |
| Molecular Formula | C19H18FN3O |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-(5-fluoro-2-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | Cc1ccc(F)cc1NC(=O)N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C19H18FN3O/c1-12-6-7-13(20)10-17(12)22-19(24)23-9-8-15-14-4-2-3-5-16(14)21-18(15)11-23/h2-7,10,21H,8-9,11H2,1H3,(H,22,24) |
| InChIKey | LXQNFNXPPBDIDH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|