C17H20N6O — CID 119069157
N-[1-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 119069157) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is N-[1-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | N-[1-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 119069157 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | N-[1-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | Cc1nc(C(C)NC(=O)N2CCc3c([nH]c4ccccc34)C2)n[nH]1 |
| InChI | InChI=1S/C17H20N6O/c1-10(16-19-11(2)21-22-16)18-17(24)23-8-7-13-12-5-3-4-6-14(12)20-15(13)9-23/h3-6,10,20H,7-9H2,1-2H3,(H,18,24)(H,19,21,22) |
| InChIKey | ZMTWNRZQEUDCDE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|