C25H26N2O2 — CID 102466564
methyl 5-benzyl-1,2,4a,6,7,12-hexahydroindolo[3,2-d][1]benzazepine-12b-carboxylate (PubChem CID 102466564) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is methyl 5-benzyl-1,2,4a,6,7,12-hexahydroindolo[3,2-d][1]benzazepine-12b-carboxylate.
| Compound Name | methyl 5-benzyl-1,2,4a,6,7,12-hexahydroindolo[3,2-d][1]benzazepine-12b-carboxylate |
|---|---|
| PubChem CID | 102466564 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | methyl 5-benzyl-1,2,4a,6,7,12-hexahydroindolo[3,2-d][1]benzazepine-12b-carboxylate |
| SMILES | COC(=O)C12CCC=CC1N(Cc1ccccc1)CCc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C25H26N2O2/c1-29-24(28)25-15-8-7-13-22(25)27(17-18-9-3-2-4-10-18)16-14-20-19-11-5-6-12-21(19)26-23(20)25/h2-7,9-13,22,26H,8,14-17H2,1H3 |
| InChIKey | LVZVGTSJHJPPIN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|