C21H24N2O4 — CID 10809045
methyl (8R,8aS)-1-(2-hydroxyethyl)-8-(1H-indol-2-yl)-2-oxo-4,6,7,8a-tetrahydro-3H-quinoline-8-carboxylate (PubChem CID 10809045) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is methyl (8R,8aS)-1-(2-hydroxyethyl)-8-(1H-indol-2-yl)-2-oxo-4,6,7,8a-tetrahydro-3H-quinoline-8-carboxylate.
| Compound Name | methyl (8R,8aS)-1-(2-hydroxyethyl)-8-(1H-indol-2-yl)-2-oxo-4,6,7,8a-tetrahydro-3H-quinoline-8-carboxylate |
|---|---|
| PubChem CID | 10809045 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | methyl (8R,8aS)-1-(2-hydroxyethyl)-8-(1H-indol-2-yl)-2-oxo-4,6,7,8a-tetrahydro-3H-quinoline-8-carboxylate |
| SMILES | COC(=O)[C@]1(c2cc3ccccc3[nH]2)CCC=C2CCC(=O)N(CCO)[C@@H]21 |
| InChI | InChI=1S/C21H24N2O4/c1-27-20(26)21(17-13-15-5-2-3-7-16(15)22-17)10-4-6-14-8-9-18(25)23(11-12-24)19(14)21/h2-3,5-7,13,19,22,24H,4,8-12H2,1H3/t19-,21-/m0/s1 |
| InChIKey | MHFQAYBQZIYWDK-FPOVZHCZSA-N |
| XLogP | 2.28 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|