C20H18N2O3 — CID 24967591
methyl 2-(1H-indole-2-carbonylamino)-1,3-dihydroindene-2-carboxylate (PubChem CID 24967591) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is methyl 2-(1H-indole-2-carbonylamino)-1,3-dihydroindene-2-carboxylate.
| Compound Name | methyl 2-(1H-indole-2-carbonylamino)-1,3-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 24967591 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | methyl 2-(1H-indole-2-carbonylamino)-1,3-dihydroindene-2-carboxylate |
| SMILES | COC(=O)C1(NC(=O)c2cc3ccccc3[nH]2)Cc2ccccc2C1 |
| InChI | InChI=1S/C20H18N2O3/c1-25-19(24)20(11-14-7-2-3-8-15(14)12-20)22-18(23)17-10-13-6-4-5-9-16(13)21-17/h2-10,21H,11-12H2,1H3,(H,22,23) |
| InChIKey | IEVUAJJPDJRYOG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |