C21H24N2O3 — CID 98207621
methyl (5R,7R)-3-(1H-indole-2-carbonylamino)adamantane-1-carboxylate (PubChem CID 98207621) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is methyl (5R,7R)-3-(1H-indole-2-carbonylamino)adamantane-1-carboxylate.
| Compound Name | methyl (5R,7R)-3-(1H-indole-2-carbonylamino)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 98207621 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | methyl (5R,7R)-3-(1H-indole-2-carbonylamino)adamantane-1-carboxylate |
| SMILES | COC(=O)C12C[C@H]3C[C@@H](CC(NC(=O)c4cc5ccccc5[nH]4)(C3)C1)C2 |
| InChI | InChI=1S/C21H24N2O3/c1-26-19(25)20-8-13-6-14(9-20)11-21(10-13,12-20)23-18(24)17-7-15-4-2-3-5-16(15)22-17/h2-5,7,13-14,22H,6,8-12H2,1H3,(H,23,24)/t13-,14-,20?,21?/m1/s1 |
| InChIKey | SZWBDTYTDYNWPA-RKOMNEFPSA-N |
| XLogP | 3.41 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |