C21H21N3O — CID 143751482
2,2-dimethyl-1,3-dihydroindene-5-carbonitrile;1H-indole-2-carboxamide (PubChem CID 143751482) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dihydroindene-5-carbonitrile;1H-indole-2-carboxamide.
| Compound Name | 2,2-dimethyl-1,3-dihydroindene-5-carbonitrile;1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 143751482 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 2,2-dimethyl-1,3-dihydroindene-5-carbonitrile;1H-indole-2-carboxamide |
| SMILES | CC1(C)Cc2ccc(C#N)cc2C1.NC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C12H13N.C9H8N2O/c1-12(2)6-10-4-3-9(8-13)5-11(10)7-12;10-9(12)8-5-6-3-1-2-4-7(6)11-8/h3-5H,6-7H2,1-2H3;1-5,11H,(H2,10,12) |
| InChIKey | JYXLEMGFZFUYIR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |