C22H19N3O2 — CID 143751470
N-[(6-cyano-2,2-dimethyl-1,3-dihydroinden-1-yl)methylidene]-5-hydroxy-1H-indole-2-carboxamide (PubChem CID 143751470) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[(6-cyano-2,2-dimethyl-1,3-dihydroinden-1-yl)methylidene]-5-hydroxy-1H-indole-2-carboxamide.
| Compound Name | N-[(6-cyano-2,2-dimethyl-1,3-dihydroinden-1-yl)methylidene]-5-hydroxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 143751470 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[(6-cyano-2,2-dimethyl-1,3-dihydroinden-1-yl)methylidene]-5-hydroxy-1H-indole-2-carboxamide |
| SMILES | CC1(C)Cc2ccc(C#N)cc2C1/C=N/C(=O)c1cc2cc(O)ccc2[nH]1 |
| InChI | InChI=1S/C22H19N3O2/c1-22(2)10-14-4-3-13(11-23)7-17(14)18(22)12-24-21(27)20-9-15-8-16(26)5-6-19(15)25-20/h3-9,12,18,25-26H,10H2,1-2H3/b24-12+ |
| InChIKey | GWDOOTOFZHGRMU-WYMPLXKRSA-N |
| XLogP | 4.32 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|