C9H9N3O2 — CID 10877952
5-hydroxy-1H-indole-2-carbohydrazide (PubChem CID 10877952) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 5-hydroxy-1H-indole-2-carbohydrazide.
| Compound Name | 5-hydroxy-1H-indole-2-carbohydrazide |
|---|---|
| PubChem CID | 10877952 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 5-hydroxy-1H-indole-2-carbohydrazide |
| SMILES | NNC(=O)c1cc2cc(O)ccc2[nH]1 |
| InChI | InChI=1S/C9H9N3O2/c10-12-9(14)8-4-5-3-6(13)1-2-7(5)11-8/h1-4,11,13H,10H2,(H,12,14) |
| InChIKey | FHQGHBCPYTZTGM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|