C14H14IN3O2 — CID 163584737
5-hydroxy-N-[1-(1λ3-ioda-2-azacyclopenta-3,5-dien-4-yl)ethyl]-1H-indole-2-carboxamide (PubChem CID 163584737) has the molecular formula C14H14IN3O2 and a molecular weight of 383.19 g/mol. Its IUPAC name is 5-hydroxy-N-[1-(1λ3-ioda-2-azacyclopenta-3,5-dien-4-yl)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 5-hydroxy-N-[1-(1λ3-ioda-2-azacyclopenta-3,5-dien-4-yl)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 163584737 |
| Molecular Formula | C14H14IN3O2 |
| Molecular Weight | 383.19 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | 5-hydroxy-N-[1-(1λ3-ioda-2-azacyclopenta-3,5-dien-4-yl)ethyl]-1H-indole-2-carboxamide |
| SMILES | CC(NC(=O)c1cc2cc(O)ccc2[nH]1)C1=CNI=C1 |
| InChI | InChI=1S/C14H14IN3O2/c1-8(10-6-15-16-7-10)17-14(20)13-5-9-4-11(19)2-3-12(9)18-13/h2-8,16,18-19H,1H3,(H,17,20) |
| InChIKey | GKODBCNVESGHKU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|