C17H23N3O — CID 79351560
5-amino-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1H-indole-2-carboxamide (PubChem CID 79351560) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 5-amino-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1H-indole-2-carboxamide.
| Compound Name | 5-amino-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 79351560 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 5-amino-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1H-indole-2-carboxamide |
| SMILES | CC1(C)C(CNC(=O)c2cc3cc(N)ccc3[nH]2)C1(C)C |
| InChI | InChI=1S/C17H23N3O/c1-16(2)14(17(16,3)4)9-19-15(21)13-8-10-7-11(18)5-6-12(10)20-13/h5-8,14,20H,9,18H2,1-4H3,(H,19,21) |
| InChIKey | DPFZSWGXNSRMPN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|