C24H28N4O2 — CID 143751475
2,2-dimethyl-1,3-dihydroindene-5-carbonitrile;5-(2-methoxyethylamino)-1H-indole-2-carboxamide (PubChem CID 143751475) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dihydroindene-5-carbonitrile;5-(2-methoxyethylamino)-1H-indole-2-carboxamide.
| Compound Name | 2,2-dimethyl-1,3-dihydroindene-5-carbonitrile;5-(2-methoxyethylamino)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 143751475 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 2,2-dimethyl-1,3-dihydroindene-5-carbonitrile;5-(2-methoxyethylamino)-1H-indole-2-carboxamide |
| SMILES | CC1(C)Cc2ccc(C#N)cc2C1.COCCNc1ccc2[nH]c(C(N)=O)cc2c1 |
| InChI | InChI=1S/C12H15N3O2.C12H13N/c1-17-5-4-14-9-2-3-10-8(6-9)7-11(15-10)12(13)16;1-12(2)6-10-4-3-9(8-13)5-11(10)7-12/h2-3,6-7,14-15H,4-5H2,1H3,(H2,13,16);3-5H,6-7H2,1-2H3 |
| InChIKey | JKHCFUAHSTYCNJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|