C13H13NO — CID 143493984
(2S,3S)-2-formyl-2,3-dimethyl-1,3-dihydroindene-5-carbonitrile (PubChem CID 143493984) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is (2S,3S)-2-formyl-2,3-dimethyl-1,3-dihydroindene-5-carbonitrile.
| Compound Name | (2S,3S)-2-formyl-2,3-dimethyl-1,3-dihydroindene-5-carbonitrile |
|---|---|
| PubChem CID | 143493984 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (2S,3S)-2-formyl-2,3-dimethyl-1,3-dihydroindene-5-carbonitrile |
| SMILES | C[C@H]1c2cc(C#N)ccc2C[C@]1(C)C=O |
| InChI | InChI=1S/C13H13NO/c1-9-12-5-10(7-14)3-4-11(12)6-13(9,2)8-15/h3-5,8-9H,6H2,1-2H3/t9-,13+/m0/s1 |
| InChIKey | QWZVTOAATLDERP-TVQRCGJNSA-N |
| XLogP | 2.42 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|