C18H23NO — CID 144584283
2-(2,4-dimethylpentyl)-3-formyl-2,3-dihydro-1H-indene-5-carbonitrile (PubChem CID 144584283) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is 2-(2,4-dimethylpentyl)-3-formyl-2,3-dihydro-1H-indene-5-carbonitrile.
| Compound Name | 2-(2,4-dimethylpentyl)-3-formyl-2,3-dihydro-1H-indene-5-carbonitrile |
|---|---|
| PubChem CID | 144584283 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 2-(2,4-dimethylpentyl)-3-formyl-2,3-dihydro-1H-indene-5-carbonitrile |
| SMILES | CC(C)CC(C)CC1Cc2ccc(C#N)cc2C1C=O |
| InChI | InChI=1S/C18H23NO/c1-12(2)6-13(3)7-16-9-15-5-4-14(10-19)8-17(15)18(16)11-20/h4-5,8,11-13,16,18H,6-7,9H2,1-3H3 |
| InChIKey | SIDOVGFKMYWHBP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|