C17H26N2 — CID 63477609
3-(2,6-dimethylheptan-4-ylamino)-4-methylbenzonitrile (PubChem CID 63477609) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 3-(2,6-dimethylheptan-4-ylamino)-4-methylbenzonitrile.
| Compound Name | 3-(2,6-dimethylheptan-4-ylamino)-4-methylbenzonitrile |
|---|---|
| PubChem CID | 63477609 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 3-(2,6-dimethylheptan-4-ylamino)-4-methylbenzonitrile |
| SMILES | Cc1ccc(C#N)cc1NC(CC(C)C)CC(C)C |
| InChI | InChI=1S/C17H26N2/c1-12(2)8-16(9-13(3)4)19-17-10-15(11-18)7-6-14(17)5/h6-7,10,12-13,16,19H,8-9H2,1-5H3 |
| InChIKey | MWMQMSDMTFKLPE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |