C16H16N2O2 — CID 107710910
3-[1-(2,6-dihydroxyphenyl)ethylamino]-4-methylbenzonitrile (PubChem CID 107710910) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 3-[1-(2,6-dihydroxyphenyl)ethylamino]-4-methylbenzonitrile.
| Compound Name | 3-[1-(2,6-dihydroxyphenyl)ethylamino]-4-methylbenzonitrile |
|---|---|
| PubChem CID | 107710910 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3-[1-(2,6-dihydroxyphenyl)ethylamino]-4-methylbenzonitrile |
| SMILES | Cc1ccc(C#N)cc1NC(C)c1c(O)cccc1O |
| InChI | InChI=1S/C16H16N2O2/c1-10-6-7-12(9-17)8-13(10)18-11(2)16-14(19)4-3-5-15(16)20/h3-8,11,18-20H,1-2H3 |
| InChIKey | SWEKOENZYZJKPH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|