C15H16N2O4 — CID 107710663
2-[1-(2-methyl-5-nitroanilino)ethyl]benzene-1,3-diol (PubChem CID 107710663) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-[1-(2-methyl-5-nitroanilino)ethyl]benzene-1,3-diol.
| Compound Name | 2-[1-(2-methyl-5-nitroanilino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107710663 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-[1-(2-methyl-5-nitroanilino)ethyl]benzene-1,3-diol |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(C)c1c(O)cccc1O |
| InChI | InChI=1S/C15H16N2O4/c1-9-6-7-11(17(20)21)8-12(9)16-10(2)15-13(18)4-3-5-14(15)19/h3-8,10,16,18-19H,1-2H3 |
| InChIKey | BYNRZDLVSUZIHJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|