C19H22N2O3 — CID 14706149
methyl (4aS,5S)-5-(1H-indol-2-yl)-2,3,4,4a,6,8-hexahydro-1H-oxepino[4,5-c]pyridine-5-carboxylate (PubChem CID 14706149) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is methyl (4aS,5S)-5-(1H-indol-2-yl)-2,3,4,4a,6,8-hexahydro-1H-oxepino[4,5-c]pyridine-5-carboxylate.
| Compound Name | methyl (4aS,5S)-5-(1H-indol-2-yl)-2,3,4,4a,6,8-hexahydro-1H-oxepino[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 14706149 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | methyl (4aS,5S)-5-(1H-indol-2-yl)-2,3,4,4a,6,8-hexahydro-1H-oxepino[4,5-c]pyridine-5-carboxylate |
| SMILES | COC(=O)[C@@]1(c2cc3ccccc3[nH]2)COCC=C2CNCC[C@@H]21 |
| InChI | InChI=1S/C19H22N2O3/c1-23-18(22)19(17-10-13-4-2-3-5-16(13)21-17)12-24-9-7-14-11-20-8-6-15(14)19/h2-5,7,10,15,20-21H,6,8-9,11-12H2,1H3/t15-,19-/m0/s1 |
| InChIKey | WYLUMFCZYNKXNE-KXBFYZLASA-N |
| XLogP | 2.14 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|