5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid

C15H11NO2S — CID 83985773

IUPAC5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid
SMILESO=C(O)c1cc2c(s1)CCc1c-2[nH]c2ccccc12
InChIInChI=1S/C15H11NO2S/c17-15(18)13-7-10-12(19-13)6-5-9-8-3-1-2-4-11(8)16-14(9)10/h1-4,7,16H,5-6H2,(H,17,18)
InChIKeyGHDHABYOSJJKSF-UHFFFAOYSA-N
MW269.32 g/mol
LogP3.69
Rot. Bonds1

About 5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid

5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid (PubChem CID 83985773) has the molecular formula C15H11NO2S and a molecular weight of 269.32 g/mol. Its IUPAC name is 5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid.

Molecular Properties

Compound Name5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid
PubChem CID83985773
Molecular FormulaC15H11NO2S
Molecular Weight269.32 g/mol
Exact Mass269.05
IUPAC Name5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid
SMILESO=C(O)c1cc2c(s1)CCc1c-2[nH]c2ccccc12
InChIInChI=1S/C15H11NO2S/c17-15(18)13-7-10-12(19-13)6-5-9-8-3-1-2-4-11(8)16-14(9)10/h1-4,7,16H,5-6H2,(H,17,18)
InChIKeyGHDHABYOSJJKSF-UHFFFAOYSA-N
XLogP3.69
TPSA53.09 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.32
LogP ≤ 53.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid?
The IUPAC name of 5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid (CID 83985773) is 5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid.
What is the SMILES notation for 5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid?
The canonical SMILES for 5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid is O=C(O)c1cc2c(s1)CCc1c-2[nH]c2ccccc12.
What is the InChIKey of 5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid?
The InChIKey is GHDHABYOSJJKSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO2S/c17-15(18)13-7-10-12(19-13)6-5-9-8-3-1-2-4-11(8)16-14(9)10/h1-4,7,16H,5-6H2,(H,17,18).
What are the key properties of 5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid?
5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid has a molecular weight of 269.32 g/mol, XLogP of 3.69, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid is sourced from PubChem (CID 83985773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).