C15H11NO2S — CID 83985773
5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid (PubChem CID 83985773) has the molecular formula C15H11NO2S and a molecular weight of 269.32 g/mol. Its IUPAC name is 5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid.
| Compound Name | 5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid |
|---|---|
| PubChem CID | 83985773 |
| Molecular Formula | C15H11NO2S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 5,10-dihydro-4H-thieno[3,2-a]carbazole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(s1)CCc1c-2[nH]c2ccccc12 |
| InChI | InChI=1S/C15H11NO2S/c17-15(18)13-7-10-12(19-13)6-5-9-8-3-1-2-4-11(8)16-14(9)10/h1-4,7,16H,5-6H2,(H,17,18) |
| InChIKey | GHDHABYOSJJKSF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |