2-(5,10-dihydro-4H-thieno[3,2-a]carbazol-2-yl)acetic acid

C16H13NO2S — CID 83985780

IUPAC2-(5,10-dihydro-4H-thieno[3,2-a]carbazol-2-yl)acetic acid
SMILESO=C(O)Cc1cc2c(s1)CCc1c-2[nH]c2ccccc12
InChIInChI=1S/C16H13NO2S/c18-15(19)8-9-7-12-14(20-9)6-5-11-10-3-1-2-4-13(10)17-16(11)12/h1-4,7,17H,5-6,8H2,(H,18,19)
InChIKeyFEIHZLMCPCQHFH-UHFFFAOYSA-N
MW283.35 g/mol
LogP3.62
Rot. Bonds2

About 2-(5,10-dihydro-4H-thieno[3,2-a]carbazol-2-yl)acetic acid

2-(5,10-dihydro-4H-thieno[3,2-a]carbazol-2-yl)acetic acid (PubChem CID 83985780) has the molecular formula C16H13NO2S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-(5,10-dihydro-4H-thieno[3,2-a]carbazol-2-yl)acetic acid.

Molecular Properties

Compound Name2-(5,10-dihydro-4H-thieno[3,2-a]carbazol-2-yl)acetic acid
PubChem CID83985780
Molecular FormulaC16H13NO2S
Molecular Weight283.35 g/mol
Exact Mass283.07
IUPAC Name2-(5,10-dihydro-4H-thieno[3,2-a]carbazol-2-yl)acetic acid
SMILESO=C(O)Cc1cc2c(s1)CCc1c-2[nH]c2ccccc12
InChIInChI=1S/C16H13NO2S/c18-15(19)8-9-7-12-14(20-9)6-5-11-10-3-1-2-4-13(10)17-16(11)12/h1-4,7,17H,5-6,8H2,(H,18,19)
InChIKeyFEIHZLMCPCQHFH-UHFFFAOYSA-N
XLogP3.62
TPSA53.09 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.35
LogP ≤ 53.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(5,10-dihydro-4H-thieno[3,2-a]carbazol-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5,10-dihydro-4H-thieno[3,2-a]carbazol-2-yl)acetic acid?
The IUPAC name of 2-(5,10-dihydro-4H-thieno[3,2-a]carbazol-2-yl)acetic acid (CID 83985780) is 2-(5,10-dihydro-4H-thieno[3,2-a]carbazol-2-yl)acetic acid.
What is the SMILES notation for 2-(5,10-dihydro-4H-thieno[3,2-a]carbazol-2-yl)acetic acid?
The canonical SMILES for 2-(5,10-dihydro-4H-thieno[3,2-a]carbazol-2-yl)acetic acid is O=C(O)Cc1cc2c(s1)CCc1c-2[nH]c2ccccc12.
What is the InChIKey of 2-(5,10-dihydro-4H-thieno[3,2-a]carbazol-2-yl)acetic acid?
The InChIKey is FEIHZLMCPCQHFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2S/c18-15(19)8-9-7-12-14(20-9)6-5-11-10-3-1-2-4-13(10)17-16(11)12/h1-4,7,17H,5-6,8H2,(H,18,19).
What are the key properties of 2-(5,10-dihydro-4H-thieno[3,2-a]carbazol-2-yl)acetic acid?
2-(5,10-dihydro-4H-thieno[3,2-a]carbazol-2-yl)acetic acid has a molecular weight of 283.35 g/mol, XLogP of 3.62, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,10-dihydro-4H-thieno[3,2-a]carbazol-2-yl)acetic acid is sourced from PubChem (CID 83985780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).