C21H22N2OS — CID 18281127
5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (PubChem CID 18281127) has the molecular formula C21H22N2OS and a molecular weight of 350.49 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 18281127 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
| SMILES | O=C(c1cc2c(s1)CCCCC2)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C21H22N2OS/c24-21(20-12-14-6-2-1-3-9-19(14)25-20)23-11-10-18-16(13-23)15-7-4-5-8-17(15)22-18/h4-5,7-8,12,22H,1-3,6,9-11,13H2 |
| InChIKey | SPFPQUXVZCGBQW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|