C29H20F6N2 — CID 172819040
4-[2-(3-amino-9H-fluoren-4-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-9H-fluoren-3-amine (PubChem CID 172819040) has the molecular formula C29H20F6N2 and a molecular weight of 510.48 g/mol. Its IUPAC name is 4-[2-(3-amino-9H-fluoren-4-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-9H-fluoren-3-amine.
| Compound Name | 4-[2-(3-amino-9H-fluoren-4-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-9H-fluoren-3-amine |
|---|---|
| PubChem CID | 172819040 |
| Molecular Formula | C29H20F6N2 |
| Molecular Weight | 510.48 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 4-[2-(3-amino-9H-fluoren-4-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-9H-fluoren-3-amine |
| SMILES | Nc1ccc2c(c1C(c1c(N)ccc3c1-c1ccccc1C3)(C(F)(F)F)C(F)(F)F)-c1ccccc1C2 |
| InChI | InChI=1S/C29H20F6N2/c30-28(31,32)27(29(33,34)35,25-21(36)11-9-17-13-15-5-1-3-7-19(15)23(17)25)26-22(37)12-10-18-14-16-6-2-4-8-20(16)24(18)26/h1-12H,13-14,36-37H2 |
| InChIKey | TYYMHGRYVYCECM-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.48 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|