C17H16N2O — CID 139916519
17-amino-10-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2,4,6,14(18),15-hexaen-9-one (PubChem CID 139916519) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 17-amino-10-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2,4,6,14(18),15-hexaen-9-one.
| Compound Name | 17-amino-10-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2,4,6,14(18),15-hexaen-9-one |
|---|---|
| PubChem CID | 139916519 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 17-amino-10-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2,4,6,14(18),15-hexaen-9-one |
| SMILES | Nc1ccc2c3c1-c1ccccc1CC(=O)N3CCC2 |
| InChI | InChI=1S/C17H16N2O/c18-14-8-7-11-5-3-9-19-15(20)10-12-4-1-2-6-13(12)16(14)17(11)19/h1-2,4,6-8H,3,5,9-10,18H2 |
| InChIKey | PTCOBRXAPNASIA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|