C23Cl6F15N — CID 175250843
2,2,2-tris[2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]acetonitrile (PubChem CID 175250843) has the molecular formula C23Cl6F15N and a molecular weight of 787.95 g/mol. Its IUPAC name is 2,2,2-tris[2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]acetonitrile.
| Compound Name | 2,2,2-tris[2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 175250843 |
| Molecular Formula | C23Cl6F15N |
| Molecular Weight | 787.95 g/mol |
| Exact Mass | 784.79 |
| IUPAC Name | 2,2,2-tris[2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]acetonitrile |
| SMILES | N#CC(c1c(Cl)c(F)c(C(F)(F)F)c(F)c1Cl)(c1c(Cl)c(F)c(C(F)(F)F)c(F)c1Cl)c1c(Cl)c(F)c(C(F)(F)F)c(F)c1Cl |
| InChI | InChI=1S/C23Cl6F15N/c24-8-2(9(25)15(31)5(14(8)30)21(36,37)38)20(1-45,3-10(26)16(32)6(22(39,40)41)17(33)11(3)27)4-12(28)18(34)7(23(42,43)44)19(35)13(4)29 |
| InChIKey | WEWHLIVRFKIIND-UHFFFAOYSA-N |
| XLogP | 12.36 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.95 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|