C11H4Cl2F5NO2 — CID 150856894
methyl 2-cyano-2-[2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]acetate (PubChem CID 150856894) has the molecular formula C11H4Cl2F5NO2 and a molecular weight of 348.05 g/mol. Its IUPAC name is methyl 2-cyano-2-[2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]acetate.
| Compound Name | methyl 2-cyano-2-[2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 150856894 |
| Molecular Formula | C11H4Cl2F5NO2 |
| Molecular Weight | 348.05 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | methyl 2-cyano-2-[2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]acetate |
| SMILES | COC(=O)C(C#N)c1c(Cl)c(F)c(C(F)(F)F)c(F)c1Cl |
| InChI | InChI=1S/C11H4Cl2F5NO2/c1-21-10(20)3(2-19)4-6(12)8(14)5(11(16,17)18)9(15)7(4)13/h3H,1H3 |
| InChIKey | KREPVGMNAXNDRI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.05 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|