C30H2Cl6F15N3 — CID 172693133
4-[cyano-[2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]methylidene]-2,6-bis[2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hepta-2,5-dienedinitrile (PubChem CID 172693133) has the molecular formula C30H2Cl6F15N3 and a molecular weight of 902.05 g/mol. Its IUPAC name is 4-[cyano-[2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]methylidene]-2,6-bis[2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hepta-2,5-dienedinitrile.
| Compound Name | 4-[cyano-[2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]methylidene]-2,6-bis[2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hepta-2,5-dienedinitrile |
|---|---|
| PubChem CID | 172693133 |
| Molecular Formula | C30H2Cl6F15N3 |
| Molecular Weight | 902.05 g/mol |
| Exact Mass | 898.81 |
| IUPAC Name | 4-[cyano-[2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]methylidene]-2,6-bis[2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)phenyl]hepta-2,5-dienedinitrile |
| SMILES | N#CC(=CC(C=C(C#N)c1c(Cl)c(F)c(C(F)(F)F)c(F)c1Cl)=C(C#N)c1c(Cl)c(F)c(C(F)(F)F)c(F)c1Cl)c1c(Cl)c(F)c(C(F)(F)F)c(F)c1Cl |
| InChI | InChI=1S/C30H2Cl6F15N3/c31-16-10(17(32)23(38)13(22(16)37)28(43,44)45)7(3-52)1-6(9(5-54)12-20(35)26(41)15(30(49,50)51)27(42)21(12)36)2-8(4-53)11-18(33)24(39)14(29(46,47)48)25(40)19(11)34/h1-2H |
| InChIKey | BYKIFTKZXBXUGI-UHFFFAOYSA-N |
| XLogP | 13.99 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.05 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|