C7HCl4F3O — CID 139943583
2,3,4,6-tetrachloro-5-(trifluoromethyl)phenol (PubChem CID 139943583) has the molecular formula C7HCl4F3O and a molecular weight of 299.89 g/mol. Its IUPAC name is 2,3,4,6-tetrachloro-5-(trifluoromethyl)phenol.
| Compound Name | 2,3,4,6-tetrachloro-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 139943583 |
| Molecular Formula | C7HCl4F3O |
| Molecular Weight | 299.89 g/mol |
| Exact Mass | 297.87 |
| IUPAC Name | 2,3,4,6-tetrachloro-5-(trifluoromethyl)phenol |
| SMILES | Oc1c(Cl)c(Cl)c(Cl)c(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C7HCl4F3O/c8-2-1(7(12,13)14)3(9)6(15)5(11)4(2)10/h15H |
| InChIKey | IQEPXTUBROZXEB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.89 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|