C8Cl4F6O — CID 14250484
1,2,3,5-tetrachloro-4-(trifluoromethoxy)-6-(trifluoromethyl)benzene (PubChem CID 14250484) has the molecular formula C8Cl4F6O and a molecular weight of 367.89 g/mol. Its IUPAC name is 1,2,3,5-tetrachloro-4-(trifluoromethoxy)-6-(trifluoromethyl)benzene.
| Compound Name | 1,2,3,5-tetrachloro-4-(trifluoromethoxy)-6-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 14250484 |
| Molecular Formula | C8Cl4F6O |
| Molecular Weight | 367.89 g/mol |
| Exact Mass | 365.86 |
| IUPAC Name | 1,2,3,5-tetrachloro-4-(trifluoromethoxy)-6-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)Oc1c(Cl)c(Cl)c(Cl)c(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C8Cl4F6O/c9-2-1(7(13,14)15)3(10)6(5(12)4(2)11)19-8(16,17)18 |
| InChIKey | YAXUVSKBDUAQQL-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.89 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|