C11H10ClF5O — CID 176776523
3-tert-butyl-5-chloro-2,6-difluoro-4-(trifluoromethyl)phenol (PubChem CID 176776523) has the molecular formula C11H10ClF5O and a molecular weight of 288.64 g/mol. Its IUPAC name is 3-tert-butyl-5-chloro-2,6-difluoro-4-(trifluoromethyl)phenol.
| Compound Name | 3-tert-butyl-5-chloro-2,6-difluoro-4-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 176776523 |
| Molecular Formula | C11H10ClF5O |
| Molecular Weight | 288.64 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 3-tert-butyl-5-chloro-2,6-difluoro-4-(trifluoromethyl)phenol |
| SMILES | CC(C)(C)c1c(F)c(O)c(F)c(Cl)c1C(F)(F)F |
| InChI | InChI=1S/C11H10ClF5O/c1-10(2,3)5-4(11(15,16)17)6(12)8(14)9(18)7(5)13/h18H,1-3H3 |
| InChIKey | CEWVRWKDVSCFDB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.64 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|