About (3-butyl-5-methyl-1,2-oxazol-4-yl)methanamine
(3-butyl-5-methyl-1,2-oxazol-4-yl)methanamine (PubChem CID 66643513) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is (3-butyl-5-methyl-1,2-oxazol-4-yl)methanamine.
Molecular Properties
| Compound Name | (3-butyl-5-methyl-1,2-oxazol-4-yl)methanamine |
| PubChem CID | 66643513 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (3-butyl-5-methyl-1,2-oxazol-4-yl)methanamine |
| SMILES | CCCCc1noc(C)c1CN |
| InChI | InChI=1S/C9H16N2O/c1-3-4-5-9-8(6-10)7(2)12-11-9/h3-6,10H2,1-2H3 |
| InChIKey | IWBTUVQWBDLMSE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-butyl-5-methyl-1,2-oxazol-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-butyl-5-methyl-1,2-oxazol-4-yl)methanamine?
The IUPAC name of (3-butyl-5-methyl-1,2-oxazol-4-yl)methanamine (CID 66643513) is (3-butyl-5-methyl-1,2-oxazol-4-yl)methanamine.
What is the SMILES notation for (3-butyl-5-methyl-1,2-oxazol-4-yl)methanamine?
The canonical SMILES for (3-butyl-5-methyl-1,2-oxazol-4-yl)methanamine is CCCCc1noc(C)c1CN.
What is the InChIKey of (3-butyl-5-methyl-1,2-oxazol-4-yl)methanamine?
The InChIKey is IWBTUVQWBDLMSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-3-4-5-9-8(6-10)7(2)12-11-9/h3-6,10H2,1-2H3.
What are the key properties of (3-butyl-5-methyl-1,2-oxazol-4-yl)methanamine?
(3-butyl-5-methyl-1,2-oxazol-4-yl)methanamine has a molecular weight of 168.24 g/mol, XLogP of 1.78, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-butyl-5-methyl-1,2-oxazol-4-yl)methanamine is sourced from PubChem (CID 66643513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).