C16H11F5O — CID 162409528
1-(4-methylphenyl)-3-(2,3,4,5,6-pentafluorophenyl)propan-1-one (PubChem CID 162409528) has the molecular formula C16H11F5O and a molecular weight of 314.25 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(2,3,4,5,6-pentafluorophenyl)propan-1-one.
| Compound Name | 1-(4-methylphenyl)-3-(2,3,4,5,6-pentafluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 162409528 |
| Molecular Formula | C16H11F5O |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 1-(4-methylphenyl)-3-(2,3,4,5,6-pentafluorophenyl)propan-1-one |
| SMILES | Cc1ccc(C(=O)CCc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C16H11F5O/c1-8-2-4-9(5-3-8)11(22)7-6-10-12(17)14(19)16(21)15(20)13(10)18/h2-5H,6-7H2,1H3 |
| InChIKey | KVYKZXPEMRTUCK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|