C15H9F5O — CID 61078269
2-(4-methylphenyl)-1-(2,3,4,5,6-pentafluorophenyl)ethanone (PubChem CID 61078269) has the molecular formula C15H9F5O and a molecular weight of 300.23 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1-(2,3,4,5,6-pentafluorophenyl)ethanone.
| Compound Name | 2-(4-methylphenyl)-1-(2,3,4,5,6-pentafluorophenyl)ethanone |
|---|---|
| PubChem CID | 61078269 |
| Molecular Formula | C15H9F5O |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-(4-methylphenyl)-1-(2,3,4,5,6-pentafluorophenyl)ethanone |
| SMILES | Cc1ccc(CC(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H9F5O/c1-7-2-4-8(5-3-7)6-9(21)10-11(16)13(18)15(20)14(19)12(10)17/h2-5H,6H2,1H3 |
| InChIKey | DGGUEZPSRBFKAY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|