C21H10F5NOS — CID 157105771
2-[4-(1,3-benzothiazol-2-yl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)ethanone (PubChem CID 157105771) has the molecular formula C21H10F5NOS and a molecular weight of 419.37 g/mol. Its IUPAC name is 2-[4-(1,3-benzothiazol-2-yl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)ethanone.
| Compound Name | 2-[4-(1,3-benzothiazol-2-yl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)ethanone |
|---|---|
| PubChem CID | 157105771 |
| Molecular Formula | C21H10F5NOS |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | 2-[4-(1,3-benzothiazol-2-yl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(-c2nc3ccccc3s2)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H10F5NOS/c22-16-15(17(23)19(25)20(26)18(16)24)13(28)9-10-5-7-11(8-6-10)21-27-12-3-1-2-4-14(12)29-21/h1-8H,9H2 |
| InChIKey | AGHAEUCPJGTQPH-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|