C17H11NO2S — CID 95909315
prop-2-ynyl 4-(1,3-benzothiazol-2-yl)benzoate (PubChem CID 95909315) has the molecular formula C17H11NO2S and a molecular weight of 293.35 g/mol. Its IUPAC name is prop-2-ynyl 4-(1,3-benzothiazol-2-yl)benzoate.
| Compound Name | prop-2-ynyl 4-(1,3-benzothiazol-2-yl)benzoate |
|---|---|
| PubChem CID | 95909315 |
| Molecular Formula | C17H11NO2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | prop-2-ynyl 4-(1,3-benzothiazol-2-yl)benzoate |
| SMILES | C#CCOC(=O)c1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C17H11NO2S/c1-2-11-20-17(19)13-9-7-12(8-10-13)16-18-14-5-3-4-6-15(14)21-16/h1,3-10H,11H2 |
| InChIKey | UTWZRTYUHNBVLR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|