C19H15NO2S2 — CID 4026532
4-(1,3-benzothiazol-2-ylsulfanyl)but-2-ynyl 4-methylbenzoate (PubChem CID 4026532) has the molecular formula C19H15NO2S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)but-2-ynyl 4-methylbenzoate.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)but-2-ynyl 4-methylbenzoate |
|---|---|
| PubChem CID | 4026532 |
| Molecular Formula | C19H15NO2S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)but-2-ynyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC#CCSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H15NO2S2/c1-14-8-10-15(11-9-14)18(21)22-12-4-5-13-23-19-20-16-6-2-3-7-17(16)24-19/h2-3,6-11H,12-13H2,1H3 |
| InChIKey | UTZXZDFGVJUDCI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|