C18H12BrNO2S2 — CID 2252904
4-(1,3-benzothiazol-2-ylsulfanyl)but-2-ynyl 4-bromobenzoate (PubChem CID 2252904) has the molecular formula C18H12BrNO2S2 and a molecular weight of 418.34 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)but-2-ynyl 4-bromobenzoate.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)but-2-ynyl 4-bromobenzoate |
|---|---|
| PubChem CID | 2252904 |
| Molecular Formula | C18H12BrNO2S2 |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 416.95 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)but-2-ynyl 4-bromobenzoate |
| SMILES | O=C(OCC#CCSc1nc2ccccc2s1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H12BrNO2S2/c19-14-9-7-13(8-10-14)17(21)22-11-3-4-12-23-18-20-15-5-1-2-6-16(15)24-18/h1-2,5-10H,11-12H2 |
| InChIKey | OJYLWQRAMCFBSS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|