C16H12N2O3S3 — CID 19698753
1,3-benzothiazol-2-ylsulfanylmethyl thiocyanate;4-hydroxybenzoic acid (PubChem CID 19698753) has the molecular formula C16H12N2O3S3 and a molecular weight of 376.48 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylsulfanylmethyl thiocyanate;4-hydroxybenzoic acid.
| Compound Name | 1,3-benzothiazol-2-ylsulfanylmethyl thiocyanate;4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 19698753 |
| Molecular Formula | C16H12N2O3S3 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 1,3-benzothiazol-2-ylsulfanylmethyl thiocyanate;4-hydroxybenzoic acid |
| SMILES | N#CSCSc1nc2ccccc2s1.O=C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H6N2S3.C7H6O3/c10-5-12-6-13-9-11-7-3-1-2-4-8(7)14-9;8-6-3-1-5(2-4-6)7(9)10/h1-4H,6H2;1-4,8H,(H,9,10) |
| InChIKey | NWRLEICIDXQRAI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|