C12H6N4S5 — CID 121295178
[1,3-benzothiazol-2-yl(dithiocyanato)methyl]sulfanylmethyl thiocyanate (PubChem CID 121295178) has the molecular formula C12H6N4S5 and a molecular weight of 366.54 g/mol. Its IUPAC name is [1,3-benzothiazol-2-yl(dithiocyanato)methyl]sulfanylmethyl thiocyanate.
| Compound Name | [1,3-benzothiazol-2-yl(dithiocyanato)methyl]sulfanylmethyl thiocyanate |
|---|---|
| PubChem CID | 121295178 |
| Molecular Formula | C12H6N4S5 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 365.92 |
| IUPAC Name | [1,3-benzothiazol-2-yl(dithiocyanato)methyl]sulfanylmethyl thiocyanate |
| SMILES | N#CSCSC(SC#N)(SC#N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H6N4S5/c13-5-17-8-20-12(18-6-14,19-7-15)11-16-9-3-1-2-4-10(9)21-11/h1-4H,8H2 |
| InChIKey | VCTPNXGKVWPYQG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 84.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|