C15H16N2S — CID 113435213
1-(1,3-benzothiazol-2-ylmethyl)cyclohexane-1-carbonitrile (PubChem CID 113435213) has the molecular formula C15H16N2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)cyclohexane-1-carbonitrile.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 113435213 |
| Molecular Formula | C15H16N2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)cyclohexane-1-carbonitrile |
| SMILES | N#CC1(Cc2nc3ccccc3s2)CCCCC1 |
| InChI | InChI=1S/C15H16N2S/c16-11-15(8-4-1-5-9-15)10-14-17-12-6-2-3-7-13(12)18-14/h2-3,6-7H,1,4-5,8-10H2 |
| InChIKey | VPUHYNAPCVKJGP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |