C16H16N2O2S — CID 60584037
1,3-benzothiazol-2-ylmethyl 1-cyanocyclohexane-1-carboxylate (PubChem CID 60584037) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 1-cyanocyclohexane-1-carboxylate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 1-cyanocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 60584037 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 1-cyanocyclohexane-1-carboxylate |
| SMILES | N#CC1(C(=O)OCc2nc3ccccc3s2)CCCCC1 |
| InChI | InChI=1S/C16H16N2O2S/c17-11-16(8-4-1-5-9-16)15(19)20-10-14-18-12-6-2-3-7-13(12)21-14/h2-3,6-7H,1,4-5,8-10H2 |
| InChIKey | WOJUPJYKRFWLFN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |