About (4-chlorophenyl)methyl 1-cyanocyclohexane-1-carboxylate
(4-chlorophenyl)methyl 1-cyanocyclohexane-1-carboxylate (PubChem CID 60584159) has the molecular formula C15H16ClNO2
and a molecular weight of 277.75 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 1-cyanocyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (4-chlorophenyl)methyl 1-cyanocyclohexane-1-carboxylate |
| PubChem CID | 60584159 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | (4-chlorophenyl)methyl 1-cyanocyclohexane-1-carboxylate |
| SMILES | N#CC1(C(=O)OCc2ccc(Cl)cc2)CCCCC1 |
| InChI | InChI=1S/C15H16ClNO2/c16-13-6-4-12(5-7-13)10-19-14(18)15(11-17)8-2-1-3-9-15/h4-7H,1-3,8-10H2 |
| InChIKey | ZPWNWLXKJASURI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-chlorophenyl)methyl 1-cyanocyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)methyl 1-cyanocyclohexane-1-carboxylate?
The IUPAC name of (4-chlorophenyl)methyl 1-cyanocyclohexane-1-carboxylate (CID 60584159) is (4-chlorophenyl)methyl 1-cyanocyclohexane-1-carboxylate.
What is the SMILES notation for (4-chlorophenyl)methyl 1-cyanocyclohexane-1-carboxylate?
The canonical SMILES for (4-chlorophenyl)methyl 1-cyanocyclohexane-1-carboxylate is N#CC1(C(=O)OCc2ccc(Cl)cc2)CCCCC1.
What is the InChIKey of (4-chlorophenyl)methyl 1-cyanocyclohexane-1-carboxylate?
The InChIKey is ZPWNWLXKJASURI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClNO2/c16-13-6-4-12(5-7-13)10-19-14(18)15(11-17)8-2-1-3-9-15/h4-7H,1-3,8-10H2.
What are the key properties of (4-chlorophenyl)methyl 1-cyanocyclohexane-1-carboxylate?
(4-chlorophenyl)methyl 1-cyanocyclohexane-1-carboxylate has a molecular weight of 277.75 g/mol, XLogP of 3.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl 1-cyanocyclohexane-1-carboxylate is sourced from PubChem (CID 60584159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).