C16H22ClNO2 — CID 115442908
(4-chlorophenyl)methyl 1-(aminomethyl)-4-methylcyclohexane-1-carboxylate (PubChem CID 115442908) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 1-(aminomethyl)-4-methylcyclohexane-1-carboxylate.
| Compound Name | (4-chlorophenyl)methyl 1-(aminomethyl)-4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 115442908 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (4-chlorophenyl)methyl 1-(aminomethyl)-4-methylcyclohexane-1-carboxylate |
| SMILES | CC1CCC(CN)(C(=O)OCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H22ClNO2/c1-12-6-8-16(11-18,9-7-12)15(19)20-10-13-2-4-14(17)5-3-13/h2-5,12H,6-11,18H2,1H3 |
| InChIKey | GDNOFEKKLDIWRU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |