C22H22ClN3O3 — CID 60584363
4-[(4-chlorophenoxy)methyl]-N'-(1-cyanocyclohexanecarbonyl)benzohydrazide (PubChem CID 60584363) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is 4-[(4-chlorophenoxy)methyl]-N'-(1-cyanocyclohexanecarbonyl)benzohydrazide.
| Compound Name | 4-[(4-chlorophenoxy)methyl]-N'-(1-cyanocyclohexanecarbonyl)benzohydrazide |
|---|---|
| PubChem CID | 60584363 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 4-[(4-chlorophenoxy)methyl]-N'-(1-cyanocyclohexanecarbonyl)benzohydrazide |
| SMILES | N#CC1(C(=O)NNC(=O)c2ccc(COc3ccc(Cl)cc3)cc2)CCCCC1 |
| InChI | InChI=1S/C22H22ClN3O3/c23-18-8-10-19(11-9-18)29-14-16-4-6-17(7-5-16)20(27)25-26-21(28)22(15-24)12-2-1-3-13-22/h4-11H,1-3,12-14H2,(H,25,27)(H,26,28) |
| InChIKey | MIFQBRKNVVBUJR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|